C15H31N9O3 — CID 134322834
5-(diaminomethylideneamino)-2-[2-[5-(diaminomethylideneamino)pentanoylamino]propanoylamino]pentanamide (PubChem CID 134322834) has the molecular formula C15H31N9O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[2-[5-(diaminomethylideneamino)pentanoylamino]propanoylamino]pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-[2-[5-(diaminomethylideneamino)pentanoylamino]propanoylamino]pentanamide |
|---|---|
| PubChem CID | 134322834 |
| Molecular Formula | C15H31N9O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[2-[5-(diaminomethylideneamino)pentanoylamino]propanoylamino]pentanamide |
| SMILES | CC(NC(=O)CCCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C15H31N9O3/c1-9(23-11(25)6-2-3-7-21-14(17)18)13(27)24-10(12(16)26)5-4-8-22-15(19)20/h9-10H,2-8H2,1H3,(H2,16,26)(H,23,25)(H,24,27)(H4,17,18,21)(H4,19,20,22) |
| InChIKey | IVNKNTPKNWZFOE-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 230.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|