C11H21N5O4 — CID 19347851
methyl 4-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoate (PubChem CID 19347851) has the molecular formula C11H21N5O4 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl 4-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 19347851 |
| Molecular Formula | C11H21N5O4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | methyl 4-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C11H21N5O4/c1-20-9(18)5-4-8(17)16-7(10(12)19)3-2-6-15-11(13)14/h7H,2-6H2,1H3,(H2,12,19)(H,16,17)(H4,13,14,15) |
| InChIKey | WJBVIWMIELDGOK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 162.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|