C20H30N4O5 — CID 155512024
(2S)-5-(diaminomethylideneamino)-2-[[4-(2-methyl-5-propan-2-ylphenoxy)-4-oxobutanoyl]amino]pentanoic acid (PubChem CID 155512024) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[4-(2-methyl-5-propan-2-ylphenoxy)-4-oxobutanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[4-(2-methyl-5-propan-2-ylphenoxy)-4-oxobutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155512024 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[4-(2-methyl-5-propan-2-ylphenoxy)-4-oxobutanoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(C(C)C)cc1OC(=O)CCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H30N4O5/c1-12(2)14-7-6-13(3)16(11-14)29-18(26)9-8-17(25)24-15(19(27)28)5-4-10-23-20(21)22/h6-7,11-12,15H,4-5,8-10H2,1-3H3,(H,24,25)(H,27,28)(H4,21,22,23)/t15-/m0/s1 |
| InChIKey | HTUUTVGWRYAOCK-HNNXBMFYSA-N |
| XLogP | 1.43 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|