C22H34N6O4 — CID 84566591
2-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 84566591) has the molecular formula C22H34N6O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 84566591 |
| Molecular Formula | C22H34N6O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-[3-[cyclopropyl-[2-(2,5-dimethylanilino)-2-oxoethyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1ccc(C)c(NC(=O)CN(CCC(=O)NC(CCCN=C(N)N)C(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C22H34N6O4/c1-14-5-6-15(2)18(12-14)27-20(30)13-28(16-7-8-16)11-9-19(29)26-17(21(31)32)4-3-10-25-22(23)24/h5-6,12,16-17H,3-4,7-11,13H2,1-2H3,(H,26,29)(H,27,30)(H,31,32)(H4,23,24,25) |
| InChIKey | DYWQJDVTBLXNLE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|