C15H28N8O5 — CID 91366196
N'-[1-[[2-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide (PubChem CID 91366196) has the molecular formula C15H28N8O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N'-[1-[[2-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide.
| Compound Name | N'-[1-[[2-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide |
|---|---|
| PubChem CID | 91366196 |
| Molecular Formula | C15H28N8O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N'-[1-[[2-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide |
| SMILES | CC(NC(=O)CCC(N)=O)C(=O)NCC(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C15H28N8O5/c1-8(22-11(25)5-4-10(16)24)14(28)21-7-12(26)23-9(13(17)27)3-2-6-20-15(18)19/h8-9H,2-7H2,1H3,(H2,16,24)(H2,17,27)(H,21,28)(H,22,25)(H,23,26)(H4,18,19,20) |
| InChIKey | NUKMQAAQUZTLGE-UHFFFAOYSA-N |
| XLogP | -4.10 |
| TPSA | 237.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|