C15H28N8O5S — CID 101486041
(2S)-2-acetamido-N-[2-[[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 101486041) has the molecular formula C15H28N8O5S and a molecular weight of 432.51 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[2-[[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-acetamido-N-[2-[[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 101486041 |
| Molecular Formula | C15H28N8O5S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2S)-2-acetamido-N-[2-[[2-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)NCC(=O)N[C@@H](CS)C(N)=O |
| InChI | InChI=1S/C15H28N8O5S/c1-8(24)22-9(3-2-4-19-15(17)18)14(28)21-5-11(25)20-6-12(26)23-10(7-29)13(16)27/h9-10,29H,2-7H2,1H3,(H2,16,27)(H,20,25)(H,21,28)(H,22,24)(H,23,26)(H4,17,18,19)/t9-,10-/m0/s1 |
| InChIKey | VTLKNLGVBRLHRY-UWVGGRQHSA-N |
| XLogP | -4.32 |
| TPSA | 223.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|