C14H27N7O5 — CID 24886249
(4S)-5-amino-4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 24886249) has the molecular formula C14H27N7O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is (4S)-5-amino-4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 24886249 |
| Molecular Formula | C14H27N7O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (4S)-5-amino-4-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C14H27N7O5/c1-7(12(25)21-9(11(16)24)4-5-10(22)23)20-13(26)8(15)3-2-6-19-14(17)18/h7-9H,2-6,15H2,1H3,(H2,16,24)(H,20,26)(H,21,25)(H,22,23)(H4,17,18,19)/t7-,8-,9-/m0/s1 |
| InChIKey | DRYBWUXBWCIWKB-CIUDSAMLSA-N |
| XLogP | -3.29 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|