C20H37N7O4 — CID 54765659
(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-N-[(1S)-2-amino-1-cyclopentyl-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 54765659) has the molecular formula C20H37N7O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-N-[(1S)-2-amino-1-cyclopentyl-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-N-[(1S)-2-amino-1-cyclopentyl-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 54765659 |
| Molecular Formula | C20H37N7O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-N-[(1S)-2-amino-1-cyclopentyl-2-oxoethyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(N)=O)C1CCCC1)C(C)C |
| InChI | InChI=1S/C20H37N7O4/c1-11(2)15(25-12(3)28)19(31)26-14(9-6-10-24-20(22)23)18(30)27-16(17(21)29)13-7-4-5-8-13/h11,13-16H,4-10H2,1-3H3,(H2,21,29)(H,25,28)(H,26,31)(H,27,30)(H4,22,23,24)/t14-,15-,16-/m0/s1 |
| InChIKey | GIGAYQWGNYRKQB-JYJNAYRXSA-N |
| XLogP | -1.15 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|