C21H41N9O4 — CID 166903809
(2R)-2-acetamido-N-[(2S)-3-cyclobutyl-1-[[(2S)-5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]amino]-1-oxopropan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 166903809) has the molecular formula C21H41N9O4 and a molecular weight of 483.62 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[(2S)-3-cyclobutyl-1-[[(2S)-5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]amino]-1-oxopropan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2R)-2-acetamido-N-[(2S)-3-cyclobutyl-1-[[(2S)-5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]amino]-1-oxopropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 166903809 |
| Molecular Formula | C21H41N9O4 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | (2R)-2-acetamido-N-[(2S)-3-cyclobutyl-1-[[(2S)-5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]amino]-1-oxopropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)N[C@H](CCCN=C(N)N)C(=O)N[C@@H](CC1CCC1)C(=O)N[C@H](CO)CCCN=C(N)N |
| InChI | InChI=1S/C21H41N9O4/c1-13(32)28-16(8-4-10-27-21(24)25)18(33)30-17(11-14-5-2-6-14)19(34)29-15(12-31)7-3-9-26-20(22)23/h14-17,31H,2-12H2,1H3,(H,28,32)(H,29,34)(H,30,33)(H4,22,23,26)(H4,24,25,27)/t15-,16+,17-/m0/s1 |
| InChIKey | MMJOCGCEEJWPLT-BBWFWOEESA-N |
| XLogP | -2.25 |
| TPSA | 236.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|