C24H45N9O4 — CID 10530922
(2S)-2-acetamido-N-[(2S)-1-[[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)(113C)pentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-4-methylpentanamide (PubChem CID 10530922) has the molecular formula C24H45N9O4 and a molecular weight of 524.68 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-1-[[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)(113C)pentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-1-[[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)(113C)pentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10530922 |
| Molecular Formula | C24H45N9O4 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)(113C)pentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@@H](CCCN=C(N)N)/[13CH]=N/NC(N)=O |
| InChI | InChI=1S/C24H45N9O4/c1-15(2)12-19(30-16(3)34)22(36)32-20(13-17-8-5-4-6-9-17)21(35)31-18(14-29-33-24(27)37)10-7-11-28-23(25)26/h14-15,17-20H,4-13H2,1-3H3,(H,30,34)(H,31,35)(H,32,36)(H4,25,26,28)(H3,27,33,37)/b29-14+/t18-,19-,20-/m0/s1/i14+1 |
| InChIKey | WYOUBFKZYFYVCH-KTSDZTEQSA-N |
| XLogP | 0.18 |
| TPSA | 219.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|