C25H47N7O6 — CID 10053064
tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate (PubChem CID 10053064) has the molecular formula C25H47N7O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate |
|---|---|
| PubChem CID | 10053064 |
| Molecular Formula | C25H47N7O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate |
| SMILES | CC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=N/NC(N)=O)CCCCNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C25H47N7O6/c1-15(2)13-19(31-22(35)20(16(3)4)29-17(5)33)21(34)30-18(14-28-32-23(26)36)11-9-10-12-27-24(37)38-25(6,7)8/h14-16,18-20H,9-13H2,1-8H3,(H,27,37)(H,29,33)(H,30,34)(H,31,35)(H3,26,32,36)/b28-14+/t18-,19-,20-/m0/s1 |
| InChIKey | FVYCZMYUAHHDBG-ZWBPXFRXSA-N |
| XLogP | 1.51 |
| TPSA | 193.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|