C29H47N7O6 — CID 10438377
tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate (PubChem CID 10438377) has the molecular formula C29H47N7O6 and a molecular weight of 589.74 g/mol. Its IUPAC name is tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate |
|---|---|
| PubChem CID | 10438377 |
| Molecular Formula | C29H47N7O6 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | tert-butyl N-[(5S,6E)-5-[[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-6-(carbamoylhydrazinylidene)hexyl]carbamate |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=N/NC(N)=O)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H47N7O6/c1-19(2)16-23(35-26(39)24(33-20(3)37)17-21-12-8-7-9-13-21)25(38)34-22(18-32-36-27(30)40)14-10-11-15-31-28(41)42-29(4,5)6/h7-9,12-13,18-19,22-24H,10-11,14-17H2,1-6H3,(H,31,41)(H,33,37)(H,34,38)(H,35,39)(H3,30,36,40)/b32-18+/t22-,23-,24-/m0/s1 |
| InChIKey | APCPUOMIYMCURM-HZLMOMQWSA-N |
| XLogP | 2.10 |
| TPSA | 193.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|