C24H39N9O4 — CID 10006801
(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide (PubChem CID 10006801) has the molecular formula C24H39N9O4 and a molecular weight of 517.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10006801 |
| Molecular Formula | C24H39N9O4 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=N/NC(N)=O)CCCN=C(N)N |
| InChI | InChI=1S/C24H39N9O4/c1-15(2)12-19(32-22(36)20(30-16(3)34)13-17-8-5-4-6-9-17)21(35)31-18(14-29-33-24(27)37)10-7-11-28-23(25)26/h4-6,8-9,14-15,18-20H,7,10-13H2,1-3H3,(H,30,34)(H,31,35)(H,32,36)(H4,25,26,28)(H3,27,33,37)/b29-14+/t18-,19-,20-/m0/s1 |
| InChIKey | GQQGSXMQHMAWFI-CSZUWZBXSA-N |
| XLogP | -0.54 |
| TPSA | 219.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|