C21H35N9O3 — CID 10073020
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-3-methylbutanamide (PubChem CID 10073020) has the molecular formula C21H35N9O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 10073020 |
| Molecular Formula | C21H35N9O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@H](/C=N/NC(N)=O)CCCN=C(N)N |
| InChI | InChI=1S/C21H35N9O3/c1-13(2)17(29-18(31)16(22)11-14-7-4-3-5-8-14)19(32)28-15(12-27-30-21(25)33)9-6-10-26-20(23)24/h3-5,7-8,12-13,15-17H,6,9-11,22H2,1-2H3,(H,28,32)(H,29,31)(H4,23,24,26)(H3,25,30,33)/b27-12+/t15-,16-,17-/m0/s1 |
| InChIKey | UGQCPSTXPJXMSP-HHQVCWSCSA-N |
| XLogP | -1.11 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|