C18H37N9O3 — CID 10251935
(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide (PubChem CID 10251935) has the molecular formula C18H37N9O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10251935 |
| Molecular Formula | C18H37N9O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-N-[(1E,2S)-1-(carbamoylhydrazinylidene)-5-(diaminomethylideneamino)pentan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](/C=N/NC(N)=O)CCCN=C(N)N |
| InChI | InChI=1S/C18H37N9O3/c1-10(2)8-13(26-16(29)14(19)11(3)4)15(28)25-12(9-24-27-18(22)30)6-5-7-23-17(20)21/h9-14H,5-8,19H2,1-4H3,(H,25,28)(H,26,29)(H4,20,21,23)(H3,22,27,30)/b24-9+/t12-,13-,14-/m0/s1 |
| InChIKey | SPNPCRVDUXCAIK-LPSUWGPASA-N |
| XLogP | -1.31 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|