C41H53N5O8 — CID 10897933
(2R)-2-[[(2R)-2-[[(2R)-2-acetamido-4-oxo-4-(tritylamino)butanoyl]amino]-3-methylbutanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 10897933) has the molecular formula C41H53N5O8 and a molecular weight of 743.90 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2R)-2-acetamido-4-oxo-4-(tritylamino)butanoyl]amino]-3-methylbutanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[(2R)-2-acetamido-4-oxo-4-(tritylamino)butanoyl]amino]-3-methylbutanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 10897933 |
| Molecular Formula | C41H53N5O8 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.39 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2R)-2-acetamido-4-oxo-4-(tritylamino)butanoyl]amino]-3-methylbutanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(=O)N[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N[C@@H](C(=O)N[C@H](CCCCNC(=O)OC(C)(C)C)C(=O)O)C(C)C |
| InChI | InChI=1S/C41H53N5O8/c1-27(2)35(37(50)44-32(38(51)52)24-16-17-25-42-39(53)54-40(4,5)6)45-36(49)33(43-28(3)47)26-34(48)46-41(29-18-10-7-11-19-29,30-20-12-8-13-21-30)31-22-14-9-15-23-31/h7-15,18-23,27,32-33,35H,16-17,24-26H2,1-6H3,(H,42,53)(H,43,47)(H,44,50)(H,45,49)(H,46,48)(H,51,52)/t32-,33-,35-/m1/s1 |
| InChIKey | BFKYJMIZYYPQRH-LRIXUHJYSA-N |
| XLogP | 4.39 |
| TPSA | 192.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|