C25H37N7O4 — CID 176545440
N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[2-(cyclohexylamino)-4-oxobut-3-enoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 176545440) has the molecular formula C25H37N7O4 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[2-(cyclohexylamino)-4-oxobut-3-enoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[2-(cyclohexylamino)-4-oxobut-3-enoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 176545440 |
| Molecular Formula | C25H37N7O4 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[2-(cyclohexylamino)-4-oxobut-3-enoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(C=C=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H37N7O4/c26-22(34)21(16-17-8-3-1-4-9-17)32-23(35)19(12-7-14-29-25(27)28)31-24(36)20(13-15-33)30-18-10-5-2-6-11-18/h1,3-4,8-9,13,18-21,30H,2,5-7,10-12,14,16H2,(H2,26,34)(H,31,36)(H,32,35)(H4,27,28,29) |
| InChIKey | ZLLLLJUNBNCTCH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|