C30H43N9O4 — CID 174431705
6-amino-N-[1-[[1-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-cyclohexylpyridine-3-carboxamide (PubChem CID 174431705) has the molecular formula C30H43N9O4 and a molecular weight of 593.73 g/mol. Its IUPAC name is 6-amino-N-[1-[[1-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-cyclohexylpyridine-3-carboxamide.
| Compound Name | 6-amino-N-[1-[[1-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-cyclohexylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 174431705 |
| Molecular Formula | C30H43N9O4 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 6-amino-N-[1-[[1-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-cyclohexylpyridine-3-carboxamide |
| SMILES | CC(C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(N)=O)N(C(=O)c1ccc(N)nc1)C1CCCCC1 |
| InChI | InChI=1S/C30H43N9O4/c1-19(39(22-11-6-3-7-12-22)29(43)21-14-15-25(31)36-18-21)27(41)37-23(13-8-16-35-30(33)34)28(42)38-24(26(32)40)17-20-9-4-2-5-10-20/h2,4-5,9-10,14-15,18-19,22-24H,3,6-8,11-13,16-17H2,1H3,(H2,31,36)(H2,32,40)(H,37,41)(H,38,42)(H4,33,34,35) |
| InChIKey | KEVYEWKCRXLGNK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 224.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|