C26H36N6O7 — CID 67111871
(4S)-4-amino-5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-5-oxopentanoic acid;4-hydroxybenzoic acid (PubChem CID 67111871) has the molecular formula C26H36N6O7 and a molecular weight of 544.61 g/mol. Its IUPAC name is (4S)-4-amino-5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-5-oxopentanoic acid;4-hydroxybenzoic acid.
| Compound Name | (4S)-4-amino-5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-5-oxopentanoic acid;4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 67111871 |
| Molecular Formula | C26H36N6O7 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-5-oxopentanoic acid;4-hydroxybenzoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)NCCc1ccccc1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H30N6O4.C7H6O3/c20-14(8-9-16(26)27)17(28)25-15(7-4-11-24-19(21)22)18(29)23-12-10-13-5-2-1-3-6-13;8-6-3-1-5(2-4-6)7(9)10/h1-3,5-6,14-15H,4,7-12,20H2,(H,23,29)(H,25,28)(H,26,27)(H4,21,22,24);1-4,8H,(H,9,10)/t14-,15-;/m0./s1 |
| InChIKey | CKYINMWACHCPFL-YYLIZZNMSA-N |
| XLogP | 0.17 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|