C33H47NO6 — CID 167569974
benzyl (3S)-3-[[(2S)-5-benzyl-3-oxo-6,6-di(propan-2-yloxy)hexan-2-yl]carbamoyl]-4-methylpentanoate (PubChem CID 167569974) has the molecular formula C33H47NO6 and a molecular weight of 553.74 g/mol. Its IUPAC name is benzyl (3S)-3-[[(2S)-5-benzyl-3-oxo-6,6-di(propan-2-yloxy)hexan-2-yl]carbamoyl]-4-methylpentanoate.
| Compound Name | benzyl (3S)-3-[[(2S)-5-benzyl-3-oxo-6,6-di(propan-2-yloxy)hexan-2-yl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 167569974 |
| Molecular Formula | C33H47NO6 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | benzyl (3S)-3-[[(2S)-5-benzyl-3-oxo-6,6-di(propan-2-yloxy)hexan-2-yl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)OC(OC(C)C)C(CC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)OCc1ccccc1)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C33H47NO6/c1-22(2)29(20-31(36)38-21-27-16-12-9-13-17-27)32(37)34-25(7)30(35)19-28(18-26-14-10-8-11-15-26)33(39-23(3)4)40-24(5)6/h8-17,22-25,28-29,33H,18-21H2,1-7H3,(H,34,37)/t25-,28?,29-/m0/s1 |
| InChIKey | FTVFBRCPPFRZAG-VNIGXVFMSA-N |
| XLogP | 5.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|