C30H49NO6 — CID 167587922
benzyl (3S)-3-[[(2S)-5-[di(propan-2-yloxy)methyl]-7-methyl-3-oxooctan-2-yl]carbamoyl]-4-methylpentanoate (PubChem CID 167587922) has the molecular formula C30H49NO6 and a molecular weight of 519.72 g/mol. Its IUPAC name is benzyl (3S)-3-[[(2S)-5-[di(propan-2-yloxy)methyl]-7-methyl-3-oxooctan-2-yl]carbamoyl]-4-methylpentanoate.
| Compound Name | benzyl (3S)-3-[[(2S)-5-[di(propan-2-yloxy)methyl]-7-methyl-3-oxooctan-2-yl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 167587922 |
| Molecular Formula | C30H49NO6 |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | benzyl (3S)-3-[[(2S)-5-[di(propan-2-yloxy)methyl]-7-methyl-3-oxooctan-2-yl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)CC(CC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)OCc1ccccc1)C(C)C)C(OC(C)C)OC(C)C |
| InChI | InChI=1S/C30H49NO6/c1-19(2)15-25(30(36-21(5)6)37-22(7)8)16-27(32)23(9)31-29(34)26(20(3)4)17-28(33)35-18-24-13-11-10-12-14-24/h10-14,19-23,25-26,30H,15-18H2,1-9H3,(H,31,34)/t23-,25?,26-/m0/s1 |
| InChIKey | IASUQDUGDZVRBU-RRLIAEKXSA-N |
| XLogP | 5.69 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|