About 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate
5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate (PubChem CID 66887600) has the molecular formula C24H37NO6
and a molecular weight of 435.56 g/mol. Its IUPAC name is 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate |
| PubChem CID | 66887600 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate |
| SMILES | CC(C)CC(CC(=O)OCc1ccccc1)C(N)C(=O)OC(OC(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C24H37NO6/c1-15(2)12-19(13-20(26)29-14-18-10-8-7-9-11-18)21(25)23(28)31-24(17(5)6)30-22(27)16(3)4/h7-11,15-17,19,21,24H,12-14,25H2,1-6H3 |
| InChIKey | PNRPVGVKOCYYCE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate?
The IUPAC name of 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate (CID 66887600) is 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate is CC(C)CC(CC(=O)OCc1ccccc1)C(N)C(=O)OC(OC(=O)C(C)C)C(C)C.
What is the InChIKey of 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate?
The InChIKey is PNRPVGVKOCYYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37NO6/c1-15(2)12-19(13-20(26)29-14-18-10-8-7-9-11-18)21(25)23(28)31-24(17(5)6)30-22(27)16(3)4/h7-11,15-17,19,21,24H,12-14,25H2,1-6H3.
What are the key properties of 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate?
5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate has a molecular weight of 435.56 g/mol, XLogP of 3.83, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-[2-methyl-1-(2-methylpropanoyloxy)propyl] 2-amino-3-(2-methylpropyl)pentanedioate is sourced from PubChem (CID 66887600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).