C21H33NO2 — CID 101455107
methyl (2S)-2-[[(1S)-1-cyclohexyl-3-phenylpropyl]amino]-3-methylbutanoate (PubChem CID 101455107) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S)-1-cyclohexyl-3-phenylpropyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(1S)-1-cyclohexyl-3-phenylpropyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 101455107 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | methyl (2S)-2-[[(1S)-1-cyclohexyl-3-phenylpropyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](N[C@@H](CCc1ccccc1)C1CCCCC1)C(C)C |
| InChI | InChI=1S/C21H33NO2/c1-16(2)20(21(23)24-3)22-19(18-12-8-5-9-13-18)15-14-17-10-6-4-7-11-17/h4,6-7,10-11,16,18-20,22H,5,8-9,12-15H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | VJWHADFRJRPUPT-PMACEKPBSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |