C16H24 — CID 102579407
[(3R)-3-cyclohexylbutyl]benzene (PubChem CID 102579407) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is [(3R)-3-cyclohexylbutyl]benzene.
| Compound Name | [(3R)-3-cyclohexylbutyl]benzene |
|---|---|
| PubChem CID | 102579407 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | [(3R)-3-cyclohexylbutyl]benzene |
| SMILES | C[C@H](CCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H24/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2,4-5,8-9,14,16H,3,6-7,10-13H2,1H3/t14-/m1/s1 |
| InChIKey | JEZUOOSANNCVIJ-CQSZACIVSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |