C17H24O — CID 134922324
(2R)-2-[(2R)-4-phenylbutan-2-yl]cycloheptan-1-one (PubChem CID 134922324) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (2R)-2-[(2R)-4-phenylbutan-2-yl]cycloheptan-1-one.
| Compound Name | (2R)-2-[(2R)-4-phenylbutan-2-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 134922324 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2R)-2-[(2R)-4-phenylbutan-2-yl]cycloheptan-1-one |
| SMILES | C[C@H](CCc1ccccc1)[C@H]1CCCCCC1=O |
| InChI | InChI=1S/C17H24O/c1-14(12-13-15-8-4-2-5-9-15)16-10-6-3-7-11-17(16)18/h2,4-5,8-9,14,16H,3,6-7,10-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | GQPMCKAHIKXUTQ-GDBMZVCRSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |