C17H24N2O3 — CID 165352812
benzyl (3S)-3-amino-4-(cyclohexylamino)-4-oxobutanoate (PubChem CID 165352812) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-(cyclohexylamino)-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-(cyclohexylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 165352812 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | benzyl (3S)-3-amino-4-(cyclohexylamino)-4-oxobutanoate |
| SMILES | N[C@@H](CC(=O)OCc1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3/c18-15(17(21)19-14-9-5-2-6-10-14)11-16(20)22-12-13-7-3-1-4-8-13/h1,3-4,7-8,14-15H,2,5-6,9-12,18H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | PLNQZYNIRBZXDE-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |