C20H28N2O6 — CID 10763089
(2S)-2-[[(2S)-2-amino-4-cyclohexyloxy-4-oxobutanoyl]amino]-3-phenylmethoxypropanoic acid (PubChem CID 10763089) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-cyclohexyloxy-4-oxobutanoyl]amino]-3-phenylmethoxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-cyclohexyloxy-4-oxobutanoyl]amino]-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 10763089 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-cyclohexyloxy-4-oxobutanoyl]amino]-3-phenylmethoxypropanoic acid |
| SMILES | N[C@@H](CC(=O)OC1CCCCC1)C(=O)N[C@@H](COCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H28N2O6/c21-16(11-18(23)28-15-9-5-2-6-10-15)19(24)22-17(20(25)26)13-27-12-14-7-3-1-4-8-14/h1,3-4,7-8,15-17H,2,5-6,9-13,21H2,(H,22,24)(H,25,26)/t16-,17-/m0/s1 |
| InChIKey | VYZZLZSTBQUUEF-IRXDYDNUSA-N |
| XLogP | 1.37 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |