C16H22N2O5S — CID 114274822
benzyl (3S)-3-amino-4-[(1,1-dioxothian-3-yl)amino]-4-oxobutanoate (PubChem CID 114274822) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-[(1,1-dioxothian-3-yl)amino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-[(1,1-dioxothian-3-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 114274822 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | benzyl (3S)-3-amino-4-[(1,1-dioxothian-3-yl)amino]-4-oxobutanoate |
| SMILES | N[C@@H](CC(=O)OCc1ccccc1)C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O5S/c17-14(9-15(19)23-10-12-5-2-1-3-6-12)16(20)18-13-7-4-8-24(21,22)11-13/h1-3,5-6,13-14H,4,7-11,17H2,(H,18,20)/t13?,14-/m0/s1 |
| InChIKey | YQYIUHDBRFBIEL-KZUDCZAMSA-N |
| XLogP | 0.14 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |