C23H28N2O4 — CID 119245450
2-[[(2-acetamido-2-cyclopentylacetyl)amino]methyl]-3-naphthalen-2-ylpropanoic acid (PubChem CID 119245450) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[(2-acetamido-2-cyclopentylacetyl)amino]methyl]-3-naphthalen-2-ylpropanoic acid.
| Compound Name | 2-[[(2-acetamido-2-cyclopentylacetyl)amino]methyl]-3-naphthalen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 119245450 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[[(2-acetamido-2-cyclopentylacetyl)amino]methyl]-3-naphthalen-2-ylpropanoic acid |
| SMILES | CC(=O)NC(C(=O)NCC(Cc1ccc2ccccc2c1)C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C23H28N2O4/c1-15(26)25-21(18-7-3-4-8-18)22(27)24-14-20(23(28)29)13-16-10-11-17-6-2-5-9-19(17)12-16/h2,5-6,9-12,18,20-21H,3-4,7-8,13-14H2,1H3,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | RWFNUEYESMQOFB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |