C21H25NO3 — CID 120687756
2-[(2,4-dimethylpent-4-enoylamino)methyl]-3-naphthalen-2-ylpropanoic acid (PubChem CID 120687756) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[(2,4-dimethylpent-4-enoylamino)methyl]-3-naphthalen-2-ylpropanoic acid.
| Compound Name | 2-[(2,4-dimethylpent-4-enoylamino)methyl]-3-naphthalen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 120687756 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-[(2,4-dimethylpent-4-enoylamino)methyl]-3-naphthalen-2-ylpropanoic acid |
| SMILES | C=C(C)CC(C)C(=O)NCC(Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C21H25NO3/c1-14(2)10-15(3)20(23)22-13-19(21(24)25)12-16-8-9-17-6-4-5-7-18(17)11-16/h4-9,11,15,19H,1,10,12-13H2,2-3H3,(H,22,23)(H,24,25) |
| InChIKey | PEWFVHIEHOZMPI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|