C19H17NO4 — CID 97324644
(2R)-2-[(furan-3-carbonylamino)methyl]-3-naphthalen-2-ylpropanoic acid (PubChem CID 97324644) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-2-[(furan-3-carbonylamino)methyl]-3-naphthalen-2-ylpropanoic acid.
| Compound Name | (2R)-2-[(furan-3-carbonylamino)methyl]-3-naphthalen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 97324644 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R)-2-[(furan-3-carbonylamino)methyl]-3-naphthalen-2-ylpropanoic acid |
| SMILES | O=C(NC[C@@H](Cc1ccc2ccccc2c1)C(=O)O)c1ccoc1 |
| InChI | InChI=1S/C19H17NO4/c21-18(16-7-8-24-12-16)20-11-17(19(22)23)10-13-5-6-14-3-1-2-4-15(14)9-13/h1-9,12,17H,10-11H2,(H,20,21)(H,22,23)/t17-/m1/s1 |
| InChIKey | NOXISGMEDBSNHV-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |