C18H20N2O5 — CID 119233505
2-benzyl-3-[2-(furan-3-carbonylamino)propanoylamino]propanoic acid (PubChem CID 119233505) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-benzyl-3-[2-(furan-3-carbonylamino)propanoylamino]propanoic acid.
| Compound Name | 2-benzyl-3-[2-(furan-3-carbonylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119233505 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-benzyl-3-[2-(furan-3-carbonylamino)propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)NCC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c1-12(20-17(22)14-7-8-25-11-14)16(21)19-10-15(18(23)24)9-13-5-3-2-4-6-13/h2-8,11-12,15H,9-10H2,1H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | IRZUKMLLWHOVDG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |