C20H23NO3S — CID 120527148
2-(naphthalen-2-ylmethyl)-3-(thiane-4-carbonylamino)propanoic acid (PubChem CID 120527148) has the molecular formula C20H23NO3S and a molecular weight of 357.47 g/mol. Its IUPAC name is 2-(naphthalen-2-ylmethyl)-3-(thiane-4-carbonylamino)propanoic acid.
| Compound Name | 2-(naphthalen-2-ylmethyl)-3-(thiane-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 120527148 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-(naphthalen-2-ylmethyl)-3-(thiane-4-carbonylamino)propanoic acid |
| SMILES | O=C(O)C(CNC(=O)C1CCSCC1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23NO3S/c22-19(16-7-9-25-10-8-16)21-13-18(20(23)24)12-14-5-6-15-3-1-2-4-17(15)11-14/h1-6,11,16,18H,7-10,12-13H2,(H,21,22)(H,23,24) |
| InChIKey | QCBWRLSKCQXTCX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |