C21H27ClN2O3 — CID 119325143
methyl 2-(naphthalen-2-ylmethyl)-3-(piperidine-2-carbonylamino)propanoate;hydrochloride (PubChem CID 119325143) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is methyl 2-(naphthalen-2-ylmethyl)-3-(piperidine-2-carbonylamino)propanoate;hydrochloride.
| Compound Name | methyl 2-(naphthalen-2-ylmethyl)-3-(piperidine-2-carbonylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119325143 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 2-(naphthalen-2-ylmethyl)-3-(piperidine-2-carbonylamino)propanoate;hydrochloride |
| SMILES | COC(=O)C(CNC(=O)C1CCCCN1)Cc1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-26-21(25)18(14-23-20(24)19-8-4-5-11-22-19)13-15-9-10-16-6-2-3-7-17(16)12-15;/h2-3,6-7,9-10,12,18-19,22H,4-5,8,11,13-14H2,1H3,(H,23,24);1H |
| InChIKey | UMJKSTARWCCRLR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |