C13H22N2O4 — CID 87040294
methyl (2S)-2-[(2-acetamido-2-cyclopentylacetyl)amino]propanoate (PubChem CID 87040294) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl (2S)-2-[(2-acetamido-2-cyclopentylacetyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(2-acetamido-2-cyclopentylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 87040294 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | methyl (2S)-2-[(2-acetamido-2-cyclopentylacetyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C(NC(C)=O)C1CCCC1 |
| InChI | InChI=1S/C13H22N2O4/c1-8(13(18)19-3)14-12(17)11(15-9(2)16)10-6-4-5-7-10/h8,10-11H,4-7H2,1-3H3,(H,14,17)(H,15,16)/t8-,11?/m0/s1 |
| InChIKey | HDAYCYSWNJBMRR-YMNIQAILSA-N |
| XLogP | 0.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |