C17H17N3O4 — CID 139908653
2-(4-carbamimidoylphenyl)-2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 139908653) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(4-carbamimidoylphenyl)-2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-(4-carbamimidoylphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 139908653 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-carbamimidoylphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(NC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17N3O4/c18-15(19)13-8-6-12(7-9-13)14(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H3,18,19)(H,20,23)(H,21,22) |
| InChIKey | SXZXXFGCCBERNJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|