C33H35N4O6P — CID 10604291
benzyl N-[(2S)-1-[[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10604291) has the molecular formula C33H35N4O6P and a molecular weight of 614.64 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10604291 |
| Molecular Formula | C33H35N4O6P |
| Molecular Weight | 614.64 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | benzyl N-[(2S)-1-[[(4-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\N)c1ccc(C(NC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)P(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H35N4O6P/c1-23(2)29(36-33(39)41-22-24-12-6-3-7-13-24)31(38)37-32(26-20-18-25(19-21-26)30(34)35)44(40,42-27-14-8-4-9-15-27)43-28-16-10-5-11-17-28/h3-21,23,29,32H,22H2,1-2H3,(H3,34,35)(H,36,39)(H,37,38)/t29-,32?/m0/s1 |
| InChIKey | STFUWKPSBLWGRE-QGFKTNLFSA-N |
| XLogP | 6.39 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|