C22H22N3O5P — CID 155519810
methyl N-[(3-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate (PubChem CID 155519810) has the molecular formula C22H22N3O5P and a molecular weight of 439.41 g/mol. Its IUPAC name is methyl N-[(3-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate.
| Compound Name | methyl N-[(3-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate |
|---|---|
| PubChem CID | 155519810 |
| Molecular Formula | C22H22N3O5P |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | methyl N-[(3-carbamimidoylphenyl)-diphenoxyphosphorylmethyl]carbamate |
| SMILES | [H]/N=C(\N)c1cccc(C(NC(=O)OC)P(=O)(Oc2ccccc2)Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N3O5P/c1-28-22(26)25-21(17-10-8-9-16(15-17)20(23)24)31(27,29-18-11-4-2-5-12-18)30-19-13-6-3-7-14-19/h2-15,21H,1H3,(H3,23,24)(H,25,26) |
| InChIKey | VNDFYKKDXBBDNB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|