About (3-carbamimidoylphenyl) (2S)-2-aminopropanoate
(3-carbamimidoylphenyl) (2S)-2-aminopropanoate (PubChem CID 68930399) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is (3-carbamimidoylphenyl) (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | (3-carbamimidoylphenyl) (2S)-2-aminopropanoate |
| PubChem CID | 68930399 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (3-carbamimidoylphenyl) (2S)-2-aminopropanoate |
| SMILES | [H]/N=C(\N)c1cccc(OC(=O)[C@H](C)N)c1 |
| InChI | InChI=1S/C10H13N3O2/c1-6(11)10(14)15-8-4-2-3-7(5-8)9(12)13/h2-6H,11H2,1H3,(H3,12,13)/t6-/m0/s1 |
| InChIKey | UQMUNQPJHFFCEZ-LURJTMIESA-N |
| XLogP | 0.22 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamimidoylphenyl) (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamimidoylphenyl) (2S)-2-aminopropanoate?
The IUPAC name of (3-carbamimidoylphenyl) (2S)-2-aminopropanoate (CID 68930399) is (3-carbamimidoylphenyl) (2S)-2-aminopropanoate.
What is the SMILES notation for (3-carbamimidoylphenyl) (2S)-2-aminopropanoate?
The canonical SMILES for (3-carbamimidoylphenyl) (2S)-2-aminopropanoate is [H]/N=C(\N)c1cccc(OC(=O)[C@H](C)N)c1.
What is the InChIKey of (3-carbamimidoylphenyl) (2S)-2-aminopropanoate?
The InChIKey is UQMUNQPJHFFCEZ-LURJTMIESA-N. The full InChI is InChI=1S/C10H13N3O2/c1-6(11)10(14)15-8-4-2-3-7(5-8)9(12)13/h2-6H,11H2,1H3,(H3,12,13)/t6-/m0/s1.
What are the key properties of (3-carbamimidoylphenyl) (2S)-2-aminopropanoate?
(3-carbamimidoylphenyl) (2S)-2-aminopropanoate has a molecular weight of 207.23 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamimidoylphenyl) (2S)-2-aminopropanoate is sourced from PubChem (CID 68930399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).