C15H17ClN2O2 — CID 82253521
3-(2-phenoxyethoxy)benzenecarboximidamide;hydrochloride (PubChem CID 82253521) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)benzenecarboximidamide;hydrochloride.
| Compound Name | 3-(2-phenoxyethoxy)benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 82253521 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-(2-phenoxyethoxy)benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C15H16N2O2.ClH/c16-15(17)12-5-4-8-14(11-12)19-10-9-18-13-6-2-1-3-7-13;/h1-8,11H,9-10H2,(H3,16,17);1H |
| InChIKey | ZPTHEZFIYFZNCD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|