C12H15F3N2O2 — CID 61491165
3-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide (PubChem CID 61491165) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide.
| Compound Name | 3-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61491165 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(OCCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)8-18-5-2-6-19-10-4-1-3-9(7-10)11(16)17/h1,3-4,7H,2,5-6,8H2,(H3,16,17) |
| InChIKey | ZHXJFFYUBABXMD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|