C24H30N6O4 — CID 10238663
3-[3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidamide (PubChem CID 10238663) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-[3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidamide.
| Compound Name | 3-[3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 10238663 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-[3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN2CCN(CCCOc3cccc(/C(N)=N/[H])c3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C24H30N6O4/c25-21(26)17-6-8-19(9-7-17)33-14-2-10-29-12-13-30(24(32)23(29)31)11-3-15-34-20-5-1-4-18(16-20)22(27)28/h1,4-9,16H,2-3,10-15H2,(H3,25,26)(H3,27,28) |
| InChIKey | WQTKIGQLCKINQJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|