C21H24N4O5S — CID 22122279
3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-thiophen-3-ylpropanoic acid (PubChem CID 22122279) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-thiophen-3-ylpropanoic acid.
| Compound Name | 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 22122279 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[4-[3-(4-carbamimidoylphenoxy)propyl]-2,3-dioxopiperazin-1-yl]-3-thiophen-3-ylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN2CCN(C(CC(=O)O)c3ccsc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c22-19(23)14-2-4-16(5-3-14)30-10-1-7-24-8-9-25(21(29)20(24)28)17(12-18(26)27)15-6-11-31-13-15/h2-6,11,13,17H,1,7-10,12H2,(H3,22,23)(H,26,27) |
| InChIKey | VHYDINHDJMBFNZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|