C28H36N4O6 — CID 58996541
ethyl 4-[3-[4-[3-[4-(C-ethoxycarbonimidoyl)phenoxy]propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidate (PubChem CID 58996541) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is ethyl 4-[3-[4-[3-[4-(C-ethoxycarbonimidoyl)phenoxy]propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidate.
| Compound Name | ethyl 4-[3-[4-[3-[4-(C-ethoxycarbonimidoyl)phenoxy]propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 58996541 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | ethyl 4-[3-[4-[3-[4-(C-ethoxycarbonimidoyl)phenoxy]propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc(OCCCN2CCN(CCCOc3ccc(/C(=N/[H])OCC)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C28H36N4O6/c1-3-35-25(29)21-7-11-23(12-8-21)37-19-5-15-31-17-18-32(28(34)27(31)33)16-6-20-38-24-13-9-22(10-14-24)26(30)36-4-2/h7-14,29-30H,3-6,15-20H2,1-2H3/b29-25-,30-26- |
| InChIKey | FLYLIORWTQNDSK-IDDWGTJGSA-N |
| XLogP | 3.32 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|