C27H38N4O3 — CID 59869046
ethyl 4-[3-[1-[3-(4-carbamimidoylphenoxy)propyl]piperidin-4-yl]propoxy]benzenecarboximidate (PubChem CID 59869046) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is ethyl 4-[3-[1-[3-(4-carbamimidoylphenoxy)propyl]piperidin-4-yl]propoxy]benzenecarboximidate.
| Compound Name | ethyl 4-[3-[1-[3-(4-carbamimidoylphenoxy)propyl]piperidin-4-yl]propoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 59869046 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | ethyl 4-[3-[1-[3-(4-carbamimidoylphenoxy)propyl]piperidin-4-yl]propoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN2CCC(CCCOc3ccc(/C(=N/[H])OCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H38N4O3/c1-2-32-27(30)23-8-12-25(13-9-23)33-19-3-5-21-14-17-31(18-15-21)16-4-20-34-24-10-6-22(7-11-24)26(28)29/h6-13,21,30H,2-5,14-20H2,1H3,(H3,28,29)/b30-27- |
| InChIKey | VQNKJCFTYBEJPT-IKPAITLHSA-N |
| XLogP | 4.67 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|