C21H37N7O — CID 11399477
4-[3-[4-[6-(diaminomethylideneamino)hexyl]piperazin-1-yl]propoxy]benzenecarboximidamide (PubChem CID 11399477) has the molecular formula C21H37N7O and a molecular weight of 403.58 g/mol. Its IUPAC name is 4-[3-[4-[6-(diaminomethylideneamino)hexyl]piperazin-1-yl]propoxy]benzenecarboximidamide.
| Compound Name | 4-[3-[4-[6-(diaminomethylideneamino)hexyl]piperazin-1-yl]propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 11399477 |
| Molecular Formula | C21H37N7O |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 4-[3-[4-[6-(diaminomethylideneamino)hexyl]piperazin-1-yl]propoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCN2CCN(CCCCCCN=C(N)N)CC2)cc1 |
| InChI | InChI=1S/C21H37N7O/c22-20(23)18-6-8-19(9-7-18)29-17-5-12-28-15-13-27(14-16-28)11-4-2-1-3-10-26-21(24)25/h6-9H,1-5,10-17H2,(H3,22,23)(H4,24,25,26) |
| InChIKey | XAMUSTSXINJRMZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|