C36H61N7O7 — CID 163441160
tert-butyl N-[4-[3-[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl]piperazin-1-yl]propoxy]benzenecarboximidoyl]carbamate (PubChem CID 163441160) has the molecular formula C36H61N7O7 and a molecular weight of 703.93 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl]piperazin-1-yl]propoxy]benzenecarboximidoyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl]piperazin-1-yl]propoxy]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 163441160 |
| Molecular Formula | C36H61N7O7 |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.46 |
| IUPAC Name | tert-butyl N-[4-[3-[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexyl]piperazin-1-yl]propoxy]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1ccc(OCCCN2CCN(CCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C36H61N7O7/c1-34(2,3)48-31(44)39-29(37)27-15-17-28(18-16-27)47-26-14-21-43-24-22-42(23-25-43)20-13-11-10-12-19-38-30(40-32(45)49-35(4,5)6)41-33(46)50-36(7,8)9/h15-18H,10-14,19-26H2,1-9H3,(H2,37,39,44)(H2,38,40,41,45,46) |
| InChIKey | AYRGIOVSCPKHDI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|