C35H66N8O6 — CID 134554238
tert-butyl N-[N-[7-[3-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptyl]-2-iminoimidazolidin-1-yl]heptyl]-C-methylcarbonimidoyl]carbamate (PubChem CID 134554238) has the molecular formula C35H66N8O6 and a molecular weight of 694.96 g/mol. Its IUPAC name is tert-butyl N-[N-[7-[3-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptyl]-2-iminoimidazolidin-1-yl]heptyl]-C-methylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[7-[3-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptyl]-2-iminoimidazolidin-1-yl]heptyl]-C-methylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 134554238 |
| Molecular Formula | C35H66N8O6 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.51 |
| IUPAC Name | tert-butyl N-[N-[7-[3-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]heptyl]-2-iminoimidazolidin-1-yl]heptyl]-C-methylcarbonimidoyl]carbamate |
| SMILES | [H]/N=C1\N(CCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CCN1CCCCCCC/N=C(\C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H66N8O6/c1-27(39-30(44)47-33(2,3)4)37-21-17-13-11-15-19-23-42-25-26-43(28(42)36)24-20-16-12-14-18-22-38-29(40-31(45)48-34(5,6)7)41-32(46)49-35(8,9)10/h36H,11-26H2,1-10H3,(H,37,39,44)(H2,38,40,41,45,46)/b36-28- |
| InChIKey | LHDYBXKQIZTTSP-DKJXEYTPSA-N |
| XLogP | 6.79 |
| TPSA | 170.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|