C15H18N2O2 — CID 141010592
tert-butyl N-(4-prop-1-ynylbenzenecarboximidoyl)carbamate (PubChem CID 141010592) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl N-(4-prop-1-ynylbenzenecarboximidoyl)carbamate.
| Compound Name | tert-butyl N-(4-prop-1-ynylbenzenecarboximidoyl)carbamate |
|---|---|
| PubChem CID | 141010592 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | tert-butyl N-(4-prop-1-ynylbenzenecarboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1ccc(C#CC)cc1 |
| InChI | InChI=1S/C15H18N2O2/c1-5-6-11-7-9-12(10-8-11)13(16)17-14(18)19-15(2,3)4/h7-10H,1-4H3,(H2,16,17,18) |
| InChIKey | BQKGBXYTOANXLO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|