C12H15ClN4O2 — CID 137346614
tert-butyl N-(3-cyanopyridine-2-carboximidoyl)carbamate;hydrochloride (PubChem CID 137346614) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is tert-butyl N-(3-cyanopyridine-2-carboximidoyl)carbamate;hydrochloride.
| Compound Name | tert-butyl N-(3-cyanopyridine-2-carboximidoyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 137346614 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | tert-butyl N-(3-cyanopyridine-2-carboximidoyl)carbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\NC(=O)OC(C)(C)C)c1ncccc1C#N |
| InChI | InChI=1S/C12H14N4O2.ClH/c1-12(2,3)18-11(17)16-10(14)9-8(7-13)5-4-6-15-9;/h4-6H,1-3H3,(H2,14,16,17);1H |
| InChIKey | UDGBCQKRZKBTPK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|